Review Article
Analysis of the Efficacy and Mechanism of Action of Xuebijing Injection on ARDS Using Meta-Analysis and Network Pharmacology
Table 2
The main active components of Xuebijing.
| Main active components of Xuebijing | Canonical SMILES |
| Safflower yellow | C1 = CC(=CC=C1C=CC(=O)C2 = C(C(C(=C(C2 = O)C=C3C(=O)C(=C(C(C3 = O)(C4C(C(C(C(O4)CO)O)O)O)O)O)C(=O)C=CC5 = CC=C(C=C5)O)O)(C6C(C(C(C(O6)CO)O)O)O)O)O)O | Danshensu | C1 = CC(=C(C=C1CC(C(=O)O)O)O)O | Ligustrazine | CC1 = C(N=C(C(=N1)C)C)C | Paeoniflorin | CC12CC3(C4CC1(C4(C(O2)O3)COC(=O)C5 = CC=CC=C5)OC6C(C(C(C(O6)CO)O)O)O)O | Ferulic acid | COC1 = C(C=CC(=C1)C=CC(=O)O)O | Protocatechualdehyde | C1 = CC(=C(C=C1C=O)O)O |
|
|